C16H16Br2N2 — CID 107603858
1-(2,6-dibromophenyl)-3-phenylpiperazine (PubChem CID 107603858) has the molecular formula C16H16Br2N2 and a molecular weight of 396.13 g/mol. Its IUPAC name is 1-(2,6-dibromophenyl)-3-phenylpiperazine.
| Compound Name | 1-(2,6-dibromophenyl)-3-phenylpiperazine |
|---|---|
| PubChem CID | 107603858 |
| Molecular Formula | C16H16Br2N2 |
| Molecular Weight | 396.13 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 1-(2,6-dibromophenyl)-3-phenylpiperazine |
| SMILES | Brc1cccc(Br)c1N1CCNC(c2ccccc2)C1 |
| InChI | InChI=1S/C16H16Br2N2/c17-13-7-4-8-14(18)16(13)20-10-9-19-15(11-20)12-5-2-1-3-6-12/h1-8,15,19H,9-11H2 |
| InChIKey | DMNIWNHKWNEOEW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.13 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |