C12H18N2 — CID 94983002
(3R)-1-methyl-3-phenyl-1,4-diazepane (PubChem CID 94983002) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (3R)-1-methyl-3-phenyl-1,4-diazepane.
| Compound Name | (3R)-1-methyl-3-phenyl-1,4-diazepane |
|---|---|
| PubChem CID | 94983002 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (3R)-1-methyl-3-phenyl-1,4-diazepane |
| SMILES | CN1CCCN[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C12H18N2/c1-14-9-5-8-13-12(10-14)11-6-3-2-4-7-11/h2-4,6-7,12-13H,5,8-10H2,1H3/t12-/m0/s1 |
| InChIKey | WXGAOXOYHDIOCF-LBPRGKRZSA-N |
| XLogP | 1.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |