C15H24N2 — CID 166503562
2,6-dimethyl-4-phenyl-1-propan-2-ylpiperazine (PubChem CID 166503562) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2,6-dimethyl-4-phenyl-1-propan-2-ylpiperazine.
| Compound Name | 2,6-dimethyl-4-phenyl-1-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 166503562 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2,6-dimethyl-4-phenyl-1-propan-2-ylpiperazine |
| SMILES | CC(C)N1C(C)CN(c2ccccc2)CC1C |
| InChI | InChI=1S/C15H24N2/c1-12(2)17-13(3)10-16(11-14(17)4)15-8-6-5-7-9-15/h5-9,12-14H,10-11H2,1-4H3 |
| InChIKey | KUQZHDZNKMVHPF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |