C17H20N2O2S — CID 110707939
1-(benzenesulfonyl)-2-methyl-4-phenylpiperazine (PubChem CID 110707939) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-methyl-4-phenylpiperazine.
| Compound Name | 1-(benzenesulfonyl)-2-methyl-4-phenylpiperazine |
|---|---|
| PubChem CID | 110707939 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-(benzenesulfonyl)-2-methyl-4-phenylpiperazine |
| SMILES | CC1CN(c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O2S/c1-15-14-18(16-8-4-2-5-9-16)12-13-19(15)22(20,21)17-10-6-3-7-11-17/h2-11,15H,12-14H2,1H3 |
| InChIKey | DYXXKDYJQDIRLJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |