About 4-phenyl-1,4-thiazine
4-phenyl-1,4-thiazine (PubChem CID 57200323) has the molecular formula C10H9NS
and a molecular weight of 175.26 g/mol. Its IUPAC name is 4-phenyl-1,4-thiazine.
Molecular Properties
| Compound Name | 4-phenyl-1,4-thiazine |
| PubChem CID | 57200323 |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 4-phenyl-1,4-thiazine |
| SMILES | C1=CN(c2ccccc2)C=CS1 |
| InChI | InChI=1S/C10H9NS/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-9H |
| InChIKey | RNGNLIBVQNTJCA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenyl-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1,4-thiazine?
The IUPAC name of 4-phenyl-1,4-thiazine (CID 57200323) is 4-phenyl-1,4-thiazine.
What is the SMILES notation for 4-phenyl-1,4-thiazine?
The canonical SMILES for 4-phenyl-1,4-thiazine is C1=CN(c2ccccc2)C=CS1.
What is the InChIKey of 4-phenyl-1,4-thiazine?
The InChIKey is RNGNLIBVQNTJCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NS/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-9H.
What are the key properties of 4-phenyl-1,4-thiazine?
4-phenyl-1,4-thiazine has a molecular weight of 175.26 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1,4-thiazine is sourced from PubChem (CID 57200323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).