About 2-phenyl-1,3,2-dithiazole
2-phenyl-1,3,2-dithiazole (PubChem CID 90302713) has the molecular formula C8H7NS2
and a molecular weight of 181.29 g/mol. Its IUPAC name is 2-phenyl-1,3,2-dithiazole.
Molecular Properties
| Compound Name | 2-phenyl-1,3,2-dithiazole |
| PubChem CID | 90302713 |
| Molecular Formula | C8H7NS2 |
| Molecular Weight | 181.29 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 2-phenyl-1,3,2-dithiazole |
| SMILES | C1=CSN(c2ccccc2)S1 |
| InChI | InChI=1S/C8H7NS2/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-7H |
| InChIKey | AVZQRWALIJXSHW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-1,3,2-dithiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,3,2-dithiazole?
The IUPAC name of 2-phenyl-1,3,2-dithiazole (CID 90302713) is 2-phenyl-1,3,2-dithiazole.
What is the SMILES notation for 2-phenyl-1,3,2-dithiazole?
The canonical SMILES for 2-phenyl-1,3,2-dithiazole is C1=CSN(c2ccccc2)S1.
What is the InChIKey of 2-phenyl-1,3,2-dithiazole?
The InChIKey is AVZQRWALIJXSHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS2/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-7H.
What are the key properties of 2-phenyl-1,3,2-dithiazole?
2-phenyl-1,3,2-dithiazole has a molecular weight of 181.29 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,3,2-dithiazole is sourced from PubChem (CID 90302713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).