C15H11NO5 — CID 174814777
3-methylfuran-2,5-dione;1-phenylpyrrole-2,5-dione (PubChem CID 174814777) has the molecular formula C15H11NO5 and a molecular weight of 285.26 g/mol. Its IUPAC name is 3-methylfuran-2,5-dione;1-phenylpyrrole-2,5-dione.
| Compound Name | 3-methylfuran-2,5-dione;1-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 174814777 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-methylfuran-2,5-dione;1-phenylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)OC1=O.O=C1C=CC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C10H7NO2.C5H4O3/c12-9-6-7-10(13)11(9)8-4-2-1-3-5-8;1-3-2-4(6)8-5(3)7/h1-7H;2H,1H3 |
| InChIKey | QOCKZQGGNBVUHR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|