C12H16N2O2 — CID 145056952
N-methylmethanamine;molecular hydrogen;1-phenylpyrrole-2,5-dione (PubChem CID 145056952) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-methylmethanamine;molecular hydrogen;1-phenylpyrrole-2,5-dione.
| Compound Name | N-methylmethanamine;molecular hydrogen;1-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 145056952 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-methylmethanamine;molecular hydrogen;1-phenylpyrrole-2,5-dione |
| SMILES | CNC.O=C1C=CC(=O)N1c1ccccc1.[H][H] |
| InChI | InChI=1S/C10H7NO2.C2H7N.H2/c12-9-6-7-10(13)11(9)8-4-2-1-3-5-8;1-3-2;/h1-7H;3H,1-2H3;1H |
| InChIKey | DAWDIWGTXLTMIZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|