C15H16N2O2 — CID 170496696
1-[4-[4-(methylamino)but-1-enyl]phenyl]pyrrole-2,5-dione (PubChem CID 170496696) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-[4-[4-(methylamino)but-1-enyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[4-(methylamino)but-1-enyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 170496696 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-[4-[4-(methylamino)but-1-enyl]phenyl]pyrrole-2,5-dione |
| SMILES | CNCCC=Cc1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C15H16N2O2/c1-16-11-3-2-4-12-5-7-13(8-6-12)17-14(18)9-10-15(17)19/h2,4-10,16H,3,11H2,1H3 |
| InChIKey | NTPFGDRTUXZXJX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|