C14H13NO2S — CID 170479284
1-[4-(4-sulfanylbut-1-enyl)phenyl]pyrrole-2,5-dione (PubChem CID 170479284) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-[4-(4-sulfanylbut-1-enyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-(4-sulfanylbut-1-enyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 170479284 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 1-[4-(4-sulfanylbut-1-enyl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(C=CCCS)cc1 |
| InChI | InChI=1S/C14H13NO2S/c16-13-8-9-14(17)15(13)12-6-4-11(5-7-12)3-1-2-10-18/h1,3-9,18H,2,10H2 |
| InChIKey | WEDADLQMYDWNJP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|