About [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene
[(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene (PubChem CID 143750489) has the molecular formula C22H19Cl2NO3
and a molecular weight of 416.30 g/mol. Its IUPAC name is [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene.
Molecular Properties
| Compound Name | [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene |
| PubChem CID | 143750489 |
| Molecular Formula | C22H19Cl2NO3 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene |
| SMILES | C=C.ClC/C=C/c1ccccc1.O=C(Cl)c1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C11H6ClNO3.C9H9Cl.C2H4/c12-11(16)7-1-3-8(4-2-7)13-9(14)5-6-10(13)15;10-8-4-7-9-5-2-1-3-6-9;1-2/h1-6H;1-7H,8H2;1-2H2/b;7-4+; |
| InChIKey | KSHCPNOMZHKYBZ-FHVKFMIDSA-N |
| XLogP | 5.24 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene?
The IUPAC name of [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene (CID 143750489) is [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene.
What is the SMILES notation for [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene?
The canonical SMILES for [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene is C=C.ClC/C=C/c1ccccc1.O=C(Cl)c1ccc(N2C(=O)C=CC2=O)cc1.
What is the InChIKey of [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene?
The InChIKey is KSHCPNOMZHKYBZ-FHVKFMIDSA-N. The full InChI is InChI=1S/C11H6ClNO3.C9H9Cl.C2H4/c12-11(16)7-1-3-8(4-2-7)13-9(14)5-6-10(13)15;10-8-4-7-9-5-2-1-3-6-9;1-2/h1-6H;1-7H,8H2;1-2H2/b;7-4+;.
What are the key properties of [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene?
[(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene has a molecular weight of 416.30 g/mol, XLogP of 5.24, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene is sourced from PubChem (CID 143750489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).