C22H19Cl2NO3 — CID 143750489
[(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene (PubChem CID 143750489) has the molecular formula C22H19Cl2NO3 and a molecular weight of 416.30 g/mol. Its IUPAC name is [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene.
| Compound Name | [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene |
|---|---|
| PubChem CID | 143750489 |
| Molecular Formula | C22H19Cl2NO3 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | [(E)-3-chloroprop-1-enyl]benzene;4-(2,5-dioxopyrrol-1-yl)benzoyl chloride;ethene |
| SMILES | C=C.ClC/C=C/c1ccccc1.O=C(Cl)c1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C11H6ClNO3.C9H9Cl.C2H4/c12-11(16)7-1-3-8(4-2-7)13-9(14)5-6-10(13)15;10-8-4-7-9-5-2-1-3-6-9;1-2/h1-6H;1-7H,8H2;1-2H2/b;7-4+; |
| InChIKey | KSHCPNOMZHKYBZ-FHVKFMIDSA-N |
| XLogP | 5.24 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|