C15H10N2O6 — CID 70630960
4-(2,5-dioxopyrrol-1-yl)benzoic acid;pyrrole-2,5-dione (PubChem CID 70630960) has the molecular formula C15H10N2O6 and a molecular weight of 314.25 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)benzoic acid;pyrrole-2,5-dione.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)benzoic acid;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 70630960 |
| Molecular Formula | C15H10N2O6 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)benzoic acid;pyrrole-2,5-dione |
| SMILES | O=C(O)c1ccc(N2C(=O)C=CC2=O)cc1.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C11H7NO4.C4H3NO2/c13-9-5-6-10(14)12(9)8-3-1-7(2-4-8)11(15)16;6-3-1-2-4(7)5-3/h1-6H,(H,15,16);1-2H,(H,5,6,7) |
| InChIKey | ZOSGMSZRPYXCRT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|