C33H22N2O4 — CID 155460089
1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]-(4-phenylphenyl)methyl]phenyl]pyrrole-2,5-dione (PubChem CID 155460089) has the molecular formula C33H22N2O4 and a molecular weight of 510.55 g/mol. Its IUPAC name is 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]-(4-phenylphenyl)methyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]-(4-phenylphenyl)methyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 155460089 |
| Molecular Formula | C33H22N2O4 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]-(4-phenylphenyl)methyl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(C(c2ccc(-c3ccccc3)cc2)c2ccc(N3C(=O)C=CC3=O)cc2)cc1 |
| InChI | InChI=1S/C33H22N2O4/c36-29-18-19-30(37)34(29)27-14-10-25(11-15-27)33(24-8-6-23(7-9-24)22-4-2-1-3-5-22)26-12-16-28(17-13-26)35-31(38)20-21-32(35)39/h1-21,33H |
| InChIKey | RIOLHQDSHWOTED-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|