C25H15N3O6 — CID 170336263
1-[4-[(2,5-dioxopyrrol-1-yl)-[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione (PubChem CID 170336263) has the molecular formula C25H15N3O6 and a molecular weight of 453.41 g/mol. Its IUPAC name is 1-[4-[(2,5-dioxopyrrol-1-yl)-[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[(2,5-dioxopyrrol-1-yl)-[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 170336263 |
| Molecular Formula | C25H15N3O6 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 1-[4-[(2,5-dioxopyrrol-1-yl)-[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(C(c2ccc(N3C(=O)C=CC3=O)cc2)N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C25H15N3O6/c29-19-9-10-20(30)26(19)17-5-1-15(2-6-17)25(28-23(33)13-14-24(28)34)16-3-7-18(8-4-16)27-21(31)11-12-22(27)32/h1-14,25H |
| InChIKey | BPMLROMBXKPUNN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|