C13H12BrNO4 — CID 171860969
1-[4-(3-bromo-1,2-dihydroxypropyl)phenyl]pyrrole-2,5-dione (PubChem CID 171860969) has the molecular formula C13H12BrNO4 and a molecular weight of 326.15 g/mol. Its IUPAC name is 1-[4-(3-bromo-1,2-dihydroxypropyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-(3-bromo-1,2-dihydroxypropyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 171860969 |
| Molecular Formula | C13H12BrNO4 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 1-[4-(3-bromo-1,2-dihydroxypropyl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(C(O)C(O)CBr)cc1 |
| InChI | InChI=1S/C13H12BrNO4/c14-7-10(16)13(19)8-1-3-9(4-2-8)15-11(17)5-6-12(15)18/h1-6,10,13,16,19H,7H2 |
| InChIKey | UAIBCTHHXKKBFE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|