C19H17NO3 — CID 86738922
1-phenylpyrrole-2,5-dione;2-prop-2-enylphenol (PubChem CID 86738922) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-phenylpyrrole-2,5-dione;2-prop-2-enylphenol.
| Compound Name | 1-phenylpyrrole-2,5-dione;2-prop-2-enylphenol |
|---|---|
| PubChem CID | 86738922 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-phenylpyrrole-2,5-dione;2-prop-2-enylphenol |
| SMILES | C=CCc1ccccc1O.O=C1C=CC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C10H7NO2.C9H10O/c12-9-6-7-10(13)11(9)8-4-2-1-3-5-8;1-2-5-8-6-3-4-7-9(8)10/h1-7H;2-4,6-7,10H,1,5H2 |
| InChIKey | QJYNDNSDQGQVFK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|