About 2-tert-butylphenol;2-prop-2-enylphenol
2-tert-butylphenol;2-prop-2-enylphenol (PubChem CID 88688446) has the molecular formula C19H24O2
and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-tert-butylphenol;2-prop-2-enylphenol.
Molecular Properties
| Compound Name | 2-tert-butylphenol;2-prop-2-enylphenol |
| PubChem CID | 88688446 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2-tert-butylphenol;2-prop-2-enylphenol |
| SMILES | C=CCc1ccccc1O.CC(C)(C)c1ccccc1O |
| InChI | InChI=1S/C10H14O.C9H10O/c1-10(2,3)8-6-4-5-7-9(8)11;1-2-5-8-6-3-4-7-9(8)10/h4-7,11H,1-3H3;2-4,6-7,10H,1,5H2 |
| InChIKey | WPGIVCYPWKSTPU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylphenol;2-prop-2-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylphenol;2-prop-2-enylphenol?
The IUPAC name of 2-tert-butylphenol;2-prop-2-enylphenol (CID 88688446) is 2-tert-butylphenol;2-prop-2-enylphenol.
What is the SMILES notation for 2-tert-butylphenol;2-prop-2-enylphenol?
The canonical SMILES for 2-tert-butylphenol;2-prop-2-enylphenol is C=CCc1ccccc1O.CC(C)(C)c1ccccc1O.
What is the InChIKey of 2-tert-butylphenol;2-prop-2-enylphenol?
The InChIKey is WPGIVCYPWKSTPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C9H10O/c1-10(2,3)8-6-4-5-7-9(8)11;1-2-5-8-6-3-4-7-9(8)10/h4-7,11H,1-3H3;2-4,6-7,10H,1,5H2.
What are the key properties of 2-tert-butylphenol;2-prop-2-enylphenol?
2-tert-butylphenol;2-prop-2-enylphenol has a molecular weight of 284.40 g/mol, XLogP of 4.81, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylphenol;2-prop-2-enylphenol is sourced from PubChem (CID 88688446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).