C16H15NO2 — CID 70255225
1-[2,6-bis(prop-2-enyl)phenyl]pyrrole-2,5-dione (PubChem CID 70255225) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-[2,6-bis(prop-2-enyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[2,6-bis(prop-2-enyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 70255225 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-[2,6-bis(prop-2-enyl)phenyl]pyrrole-2,5-dione |
| SMILES | C=CCc1cccc(CC=C)c1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H15NO2/c1-3-6-12-8-5-9-13(7-4-2)16(12)17-14(18)10-11-15(17)19/h3-5,8-11H,1-2,6-7H2 |
| InChIKey | ZJDQGXXJYBMCJU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|