About buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione
buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione (PubChem CID 174868602) has the molecular formula C23H21NO2
and a molecular weight of 343.43 g/mol. Its IUPAC name is buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione |
| PubChem CID | 174868602 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione |
| SMILES | C1=Cc2ccccc2C1.C=CC=C.O=C1C=CC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C10H7NO2.C9H8.C4H6/c12-9-6-7-10(13)11(9)8-4-2-1-3-5-8;1-2-5-9-7-3-6-8(9)4-1;1-3-4-2/h1-7H;1-6H,7H2;3-4H,1-2H2 |
| InChIKey | FROLHQKHLFGYGB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione?
The IUPAC name of buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione (CID 174868602) is buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione.
What is the SMILES notation for buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione?
The canonical SMILES for buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione is C1=Cc2ccccc2C1.C=CC=C.O=C1C=CC(=O)N1c1ccccc1.
What is the InChIKey of buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione?
The InChIKey is FROLHQKHLFGYGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.C9H8.C4H6/c12-9-6-7-10(13)11(9)8-4-2-1-3-5-8;1-2-5-9-7-3-6-8(9)4-1;1-3-4-2/h1-7H;1-6H,7H2;3-4H,1-2H2.
What are the key properties of buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione?
buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione has a molecular weight of 343.43 g/mol, XLogP of 4.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;1H-indene;1-phenylpyrrole-2,5-dione is sourced from PubChem (CID 174868602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).