C25H18N2O5 — CID 161142111
furan-2,5-dione;5-phenylpenta-2,4-dienenitrile;1-phenylpyrrole-2,5-dione (PubChem CID 161142111) has the molecular formula C25H18N2O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is furan-2,5-dione;5-phenylpenta-2,4-dienenitrile;1-phenylpyrrole-2,5-dione.
| Compound Name | furan-2,5-dione;5-phenylpenta-2,4-dienenitrile;1-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 161142111 |
| Molecular Formula | C25H18N2O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | furan-2,5-dione;5-phenylpenta-2,4-dienenitrile;1-phenylpyrrole-2,5-dione |
| SMILES | N#CC=CC=Cc1ccccc1.O=C1C=CC(=O)N1c1ccccc1.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C11H9N.C10H7NO2.C4H2O3/c12-10-6-2-5-9-11-7-3-1-4-8-11;12-9-6-7-10(13)11(9)8-4-2-1-3-5-8;5-3-1-2-4(6)7-3/h1-9H;1-7H;1-2H |
| InChIKey | UNOSTTDASQMGGW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|