C15H15NO2 — CID 54310297
5-methyl-2-phenyl-4,7-dihydroisoindole-1,3-diol (PubChem CID 54310297) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 5-methyl-2-phenyl-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 5-methyl-2-phenyl-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54310297 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 5-methyl-2-phenyl-4,7-dihydroisoindole-1,3-diol |
| SMILES | CC1=CCc2c(c(O)n(-c3ccccc3)c2O)C1 |
| InChI | InChI=1S/C15H15NO2/c1-10-7-8-12-13(9-10)15(18)16(14(12)17)11-5-3-2-4-6-11/h2-7,17-18H,8-9H2,1H3 |
| InChIKey | SKKCWXABBRNXIZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|