C14H12ClNO2 — CID 90932595
5-chloro-2-phenyl-4,5-dihydroisoindole-1,3-diol (PubChem CID 90932595) has the molecular formula C14H12ClNO2 and a molecular weight of 261.71 g/mol. Its IUPAC name is 5-chloro-2-phenyl-4,5-dihydroisoindole-1,3-diol.
| Compound Name | 5-chloro-2-phenyl-4,5-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 90932595 |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 5-chloro-2-phenyl-4,5-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1-c1ccccc1)CC(Cl)C=C2 |
| InChI | InChI=1S/C14H12ClNO2/c15-9-6-7-11-12(8-9)14(18)16(13(11)17)10-4-2-1-3-5-10/h1-7,9,17-18H,8H2 |
| InChIKey | CWJGKBKZVQRRLT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|