C19H16BrN — CID 145280447
7-bromo-3-methyl-9-phenyl-3,4-dihydrocarbazole (PubChem CID 145280447) has the molecular formula C19H16BrN and a molecular weight of 338.25 g/mol. Its IUPAC name is 7-bromo-3-methyl-9-phenyl-3,4-dihydrocarbazole.
| Compound Name | 7-bromo-3-methyl-9-phenyl-3,4-dihydrocarbazole |
|---|---|
| PubChem CID | 145280447 |
| Molecular Formula | C19H16BrN |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 7-bromo-3-methyl-9-phenyl-3,4-dihydrocarbazole |
| SMILES | CC1C=Cc2c(c3ccc(Br)cc3n2-c2ccccc2)C1 |
| InChI | InChI=1S/C19H16BrN/c1-13-7-10-18-17(11-13)16-9-8-14(20)12-19(16)21(18)15-5-3-2-4-6-15/h2-10,12-13H,11H2,1H3 |
| InChIKey | NOVKFVQBUUIJLH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |