C23H18BrN — CID 126739228
(2R)-7-bromo-2-methyl-9-naphthalen-2-yl-1,2-dihydrocarbazole (PubChem CID 126739228) has the molecular formula C23H18BrN and a molecular weight of 388.31 g/mol. Its IUPAC name is (2R)-7-bromo-2-methyl-9-naphthalen-2-yl-1,2-dihydrocarbazole.
| Compound Name | (2R)-7-bromo-2-methyl-9-naphthalen-2-yl-1,2-dihydrocarbazole |
|---|---|
| PubChem CID | 126739228 |
| Molecular Formula | C23H18BrN |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | (2R)-7-bromo-2-methyl-9-naphthalen-2-yl-1,2-dihydrocarbazole |
| SMILES | C[C@H]1C=Cc2c(n(-c3ccc4ccccc4c3)c3cc(Br)ccc23)C1 |
| InChI | InChI=1S/C23H18BrN/c1-15-6-10-20-21-11-8-18(24)14-23(21)25(22(20)12-15)19-9-7-16-4-2-3-5-17(16)13-19/h2-11,13-15H,12H2,1H3/t15-/m0/s1 |
| InChIKey | MPECQONRGAPCTJ-HNNXBMFYSA-N |
| XLogP | 6.75 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |