C59H44N6 — CID 129209891
12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-methyl-3,4-dihydrocarbazol-9-yl)phenyl]-3-methyl-11-phenyl-3,4-dihydroindolo[2,3-a]carbazole (PubChem CID 129209891) has the molecular formula C59H44N6 and a molecular weight of 837.04 g/mol. Its IUPAC name is 12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-methyl-3,4-dihydrocarbazol-9-yl)phenyl]-3-methyl-11-phenyl-3,4-dihydroindolo[2,3-a]carbazole.
| Compound Name | 12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-methyl-3,4-dihydrocarbazol-9-yl)phenyl]-3-methyl-11-phenyl-3,4-dihydroindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 129209891 |
| Molecular Formula | C59H44N6 |
| Molecular Weight | 837.04 g/mol |
| Exact Mass | 836.36 |
| IUPAC Name | 12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-methyl-3,4-dihydrocarbazol-9-yl)phenyl]-3-methyl-11-phenyl-3,4-dihydroindolo[2,3-a]carbazole |
| SMILES | CC1C=Cc2c(c3ccccc3n2-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-n3c4c(c5ccc6c7ccccc7n(-c7ccccc7)c6c53)CC(C)C=C4)c2)C1 |
| InChI | InChI=1S/C59H44N6/c1-37-26-30-53-49(32-37)46-23-13-14-24-51(46)63(53)43-34-41(59-61-57(39-16-6-3-7-17-39)60-58(62-59)40-18-8-4-9-19-40)35-44(36-43)65-54-31-27-38(2)33-50(54)48-29-28-47-45-22-12-15-25-52(45)64(55(47)56(48)65)42-20-10-5-11-21-42/h3-31,34-38H,32-33H2,1-2H3 |
| InChIKey | HDDPAKRPMIIQKU-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.04 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |