C19H16IN — CID 145291042
9-(4-iodophenyl)-3-methyl-3,4-dihydrocarbazole (PubChem CID 145291042) has the molecular formula C19H16IN and a molecular weight of 385.25 g/mol. Its IUPAC name is 9-(4-iodophenyl)-3-methyl-3,4-dihydrocarbazole.
| Compound Name | 9-(4-iodophenyl)-3-methyl-3,4-dihydrocarbazole |
|---|---|
| PubChem CID | 145291042 |
| Molecular Formula | C19H16IN |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 9-(4-iodophenyl)-3-methyl-3,4-dihydrocarbazole |
| SMILES | CC1C=Cc2c(c3ccccc3n2-c2ccc(I)cc2)C1 |
| InChI | InChI=1S/C19H16IN/c1-13-6-11-19-17(12-13)16-4-2-3-5-18(16)21(19)15-9-7-14(20)8-10-15/h2-11,13H,12H2,1H3 |
| InChIKey | IYTISXQEDRXPKT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|