C34H30N2 — CID 118507114
2-(9,9-dimethylfluoren-2-yl)-4-(3-methyl-3,4-dihydrocarbazol-9-yl)aniline (PubChem CID 118507114) has the molecular formula C34H30N2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-2-yl)-4-(3-methyl-3,4-dihydrocarbazol-9-yl)aniline.
| Compound Name | 2-(9,9-dimethylfluoren-2-yl)-4-(3-methyl-3,4-dihydrocarbazol-9-yl)aniline |
|---|---|
| PubChem CID | 118507114 |
| Molecular Formula | C34H30N2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2-(9,9-dimethylfluoren-2-yl)-4-(3-methyl-3,4-dihydrocarbazol-9-yl)aniline |
| SMILES | CC1C=Cc2c(c3ccccc3n2-c2ccc(N)c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c2)C1 |
| InChI | InChI=1S/C34H30N2/c1-21-12-17-33-28(18-21)26-9-5-7-11-32(26)36(33)23-14-16-31(35)27(20-23)22-13-15-25-24-8-4-6-10-29(24)34(2,3)30(25)19-22/h4-17,19-21H,18,35H2,1-3H3 |
| InChIKey | FQQONVYLRIBKHE-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|