C20H24N2O5Si — CID 91582389
2-phenyl-5-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)-4,7-dihydroisoindole-1,3-diol (PubChem CID 91582389) has the molecular formula C20H24N2O5Si and a molecular weight of 400.51 g/mol. Its IUPAC name is 2-phenyl-5-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-phenyl-5-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 91582389 |
| Molecular Formula | C20H24N2O5Si |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-phenyl-5-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)-4,7-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1-c1ccccc1)CC([Si]13OCCN(CCO1)CCO3)=CC2 |
| InChI | InChI=1S/C20H24N2O5Si/c23-19-17-7-6-16(28-25-11-8-21(9-12-26-28)10-13-27-28)14-18(17)20(24)22(19)15-4-2-1-3-5-15/h1-6,23-24H,7-14H2 |
| InChIKey | UIZJMJGLRGEPEM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 76.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|