C25H27GeNO3 — CID 16697456
1-trityl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane (PubChem CID 16697456) has the molecular formula C25H27GeNO3 and a molecular weight of 462.11 g/mol. Its IUPAC name is 1-trityl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane.
| Compound Name | 1-trityl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane |
|---|---|
| PubChem CID | 16697456 |
| Molecular Formula | C25H27GeNO3 |
| Molecular Weight | 462.11 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 1-trityl-2,8,9-trioxa-5-aza-1-germabicyclo[3.3.3]undecane |
| SMILES | c1ccc(C(c2ccccc2)(c2ccccc2)[Ge]23OCCN(CCO2)CCO3)cc1 |
| InChI | InChI=1S/C25H27GeNO3/c1-4-10-22(11-5-1)25(23-12-6-2-7-13-23,24-14-8-3-9-15-24)26-28-19-16-27(17-20-29-26)18-21-30-26/h1-15H,16-21H2 |
| InChIKey | YLWOETMQCFLWNY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.11 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|