C12H11NO5S — CID 23338688
2-hydroxy-4-methyl-6-oxo-1-phenylpyridine-3-sulfonic acid (PubChem CID 23338688) has the molecular formula C12H11NO5S and a molecular weight of 281.29 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-6-oxo-1-phenylpyridine-3-sulfonic acid.
| Compound Name | 2-hydroxy-4-methyl-6-oxo-1-phenylpyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 23338688 |
| Molecular Formula | C12H11NO5S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-hydroxy-4-methyl-6-oxo-1-phenylpyridine-3-sulfonic acid |
| SMILES | Cc1cc(=O)n(-c2ccccc2)c(O)c1S(=O)(=O)O |
| InChI | InChI=1S/C12H11NO5S/c1-8-7-10(14)13(9-5-3-2-4-6-9)12(15)11(8)19(16,17)18/h2-7,15H,1H3,(H,16,17,18) |
| InChIKey | XWZGMQNMYUCBAH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|