C21H18N2 — CID 142408476
6-methyl-2,3-diphenyl-7H-cyclohepta[d]imidazole (PubChem CID 142408476) has the molecular formula C21H18N2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 6-methyl-2,3-diphenyl-7H-cyclohepta[d]imidazole.
| Compound Name | 6-methyl-2,3-diphenyl-7H-cyclohepta[d]imidazole |
|---|---|
| PubChem CID | 142408476 |
| Molecular Formula | C21H18N2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 6-methyl-2,3-diphenyl-7H-cyclohepta[d]imidazole |
| SMILES | CC1=CC=c2c(nc(-c3ccccc3)n2-c2ccccc2)=CC1 |
| InChI | InChI=1S/C21H18N2/c1-16-12-14-19-20(15-13-16)23(18-10-6-3-7-11-18)21(22-19)17-8-4-2-5-9-17/h2-11,13-15H,12H2,1H3 |
| InChIKey | KAHJLTFPUDJRKQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |