C20H15N3O — CID 1490401
7-methyl-1,2-diphenylpyrido[2,3-d]pyrimidin-4-one (PubChem CID 1490401) has the molecular formula C20H15N3O and a molecular weight of 313.36 g/mol. Its IUPAC name is 7-methyl-1,2-diphenylpyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 7-methyl-1,2-diphenylpyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 1490401 |
| Molecular Formula | C20H15N3O |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 7-methyl-1,2-diphenylpyrido[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc2c(=O)nc(-c3ccccc3)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C20H15N3O/c1-14-12-13-17-19(21-14)23(16-10-6-3-7-11-16)18(22-20(17)24)15-8-4-2-5-9-15/h2-13H,1H3 |
| InChIKey | IAZVINJXHFWZJJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |