C28H24N4O — CID 20790810
2-anilino-7-methyl-3-(N-methylanilino)-1-phenyl-1,8-naphthyridin-4-one (PubChem CID 20790810) has the molecular formula C28H24N4O and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-anilino-7-methyl-3-(N-methylanilino)-1-phenyl-1,8-naphthyridin-4-one.
| Compound Name | 2-anilino-7-methyl-3-(N-methylanilino)-1-phenyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 20790810 |
| Molecular Formula | C28H24N4O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-anilino-7-methyl-3-(N-methylanilino)-1-phenyl-1,8-naphthyridin-4-one |
| SMILES | Cc1ccc2c(=O)c(N(C)c3ccccc3)c(Nc3ccccc3)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C28H24N4O/c1-20-18-19-24-26(33)25(31(2)22-14-8-4-9-15-22)28(30-21-12-6-3-7-13-21)32(27(24)29-20)23-16-10-5-11-17-23/h3-19,30H,1-2H3 |
| InChIKey | TYSDSQHQNWFBIL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |