C22H17N3O3 — CID 20791091
7-anilino-2-methyl-5-oxo-8-phenyl-1,8-naphthyridine-4-carboxylic acid (PubChem CID 20791091) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is 7-anilino-2-methyl-5-oxo-8-phenyl-1,8-naphthyridine-4-carboxylic acid.
| Compound Name | 7-anilino-2-methyl-5-oxo-8-phenyl-1,8-naphthyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 20791091 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 7-anilino-2-methyl-5-oxo-8-phenyl-1,8-naphthyridine-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c2c(=O)cc(Nc3ccccc3)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C22H17N3O3/c1-14-12-17(22(27)28)20-18(26)13-19(24-15-8-4-2-5-9-15)25(21(20)23-14)16-10-6-3-7-11-16/h2-13,24H,1H3,(H,27,28) |
| InChIKey | IBVDLPJEBGMRDZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |