C23H18ClN3O2 — CID 20791000
3-acetyl-2-(4-chloroanilino)-7-methyl-1-phenyl-1,8-naphthyridin-4-one (PubChem CID 20791000) has the molecular formula C23H18ClN3O2 and a molecular weight of 403.87 g/mol. Its IUPAC name is 3-acetyl-2-(4-chloroanilino)-7-methyl-1-phenyl-1,8-naphthyridin-4-one.
| Compound Name | 3-acetyl-2-(4-chloroanilino)-7-methyl-1-phenyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 20791000 |
| Molecular Formula | C23H18ClN3O2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-acetyl-2-(4-chloroanilino)-7-methyl-1-phenyl-1,8-naphthyridin-4-one |
| SMILES | CC(=O)c1c(Nc2ccc(Cl)cc2)n(-c2ccccc2)c2nc(C)ccc2c1=O |
| InChI | InChI=1S/C23H18ClN3O2/c1-14-8-13-19-21(29)20(15(2)28)23(26-17-11-9-16(24)10-12-17)27(22(19)25-14)18-6-4-3-5-7-18/h3-13,26H,1-2H3 |
| InChIKey | IPLWDZSAKZZXKP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |