C28H20ClN3O2 — CID 20790680
2-anilino-7-(4-chlorobenzoyl)-5-methyl-1-phenyl-1,8-naphthyridin-4-one (PubChem CID 20790680) has the molecular formula C28H20ClN3O2 and a molecular weight of 465.94 g/mol. Its IUPAC name is 2-anilino-7-(4-chlorobenzoyl)-5-methyl-1-phenyl-1,8-naphthyridin-4-one.
| Compound Name | 2-anilino-7-(4-chlorobenzoyl)-5-methyl-1-phenyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 20790680 |
| Molecular Formula | C28H20ClN3O2 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-anilino-7-(4-chlorobenzoyl)-5-methyl-1-phenyl-1,8-naphthyridin-4-one |
| SMILES | Cc1cc(C(=O)c2ccc(Cl)cc2)nc2c1c(=O)cc(Nc1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C28H20ClN3O2/c1-18-16-23(27(34)19-12-14-20(29)15-13-19)31-28-26(18)24(33)17-25(30-21-8-4-2-5-9-21)32(28)22-10-6-3-7-11-22/h2-17,30H,1H3 |
| InChIKey | YAXDACFWSIWTGV-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |