C28H22FN3O2 — CID 142224840
7-(4-fluorobenzoyl)-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-5-methyl-1-phenyl-1,8-naphthyridin-4-one (PubChem CID 142224840) has the molecular formula C28H22FN3O2 and a molecular weight of 451.50 g/mol. Its IUPAC name is 7-(4-fluorobenzoyl)-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-5-methyl-1-phenyl-1,8-naphthyridin-4-one.
| Compound Name | 7-(4-fluorobenzoyl)-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-5-methyl-1-phenyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 142224840 |
| Molecular Formula | C28H22FN3O2 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 7-(4-fluorobenzoyl)-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-5-methyl-1-phenyl-1,8-naphthyridin-4-one |
| SMILES | C=C/C=C(\C=C)Nc1cc(=O)c2c(C)cc(C(=O)c3ccc(F)cc3)nc2n1-c1ccccc1 |
| InChI | InChI=1S/C28H22FN3O2/c1-4-9-21(5-2)30-25-17-24(33)26-18(3)16-23(27(34)19-12-14-20(29)15-13-19)31-28(26)32(25)22-10-7-6-8-11-22/h4-17,30H,1-2H2,3H3/b21-9+ |
| InChIKey | STKBTTZYACIRLG-ZVBGSRNCSA-N |
| XLogP | 5.73 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|