C23H22N4O3 — CID 142224811
2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-N-methoxy-N-methyl-4-oxo-1-phenyl-1,6-naphthyridine-7-carboxamide (PubChem CID 142224811) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-N-methoxy-N-methyl-4-oxo-1-phenyl-1,6-naphthyridine-7-carboxamide.
| Compound Name | 2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-N-methoxy-N-methyl-4-oxo-1-phenyl-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 142224811 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-N-methoxy-N-methyl-4-oxo-1-phenyl-1,6-naphthyridine-7-carboxamide |
| SMILES | C=C/C=C(\C=C)Nc1cc(=O)c2cnc(C(=O)N(C)OC)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H22N4O3/c1-5-10-16(6-2)25-22-14-21(28)18-15-24-19(23(29)26(3)30-4)13-20(18)27(22)17-11-8-7-9-12-17/h5-15,25H,1-2H2,3-4H3/b16-10+ |
| InChIKey | BXMSACVZHBSWEH-MHWRWJLKSA-N |
| XLogP | 3.69 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|