C23H20FN3O2 — CID 142224562
6-fluoro-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-phenyl-7-propanoyl-1,8-naphthyridin-4-one (PubChem CID 142224562) has the molecular formula C23H20FN3O2 and a molecular weight of 389.43 g/mol. Its IUPAC name is 6-fluoro-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-phenyl-7-propanoyl-1,8-naphthyridin-4-one.
| Compound Name | 6-fluoro-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-phenyl-7-propanoyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 142224562 |
| Molecular Formula | C23H20FN3O2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 6-fluoro-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-phenyl-7-propanoyl-1,8-naphthyridin-4-one |
| SMILES | C=C/C=C(\C=C)Nc1cc(=O)c2cc(F)c(C(=O)CC)nc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H20FN3O2/c1-4-10-15(5-2)25-21-14-20(29)17-13-18(24)22(19(28)6-3)26-23(17)27(21)16-11-8-7-9-12-16/h4-5,7-14,25H,1-2,6H2,3H3/b15-10+ |
| InChIKey | WSZITFDLXQELGZ-XNTDXEJSSA-N |
| XLogP | 4.79 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|