C20H16N2O — CID 135059905
1-(4-methyl-9-phenylpyrido[2,3-b]indol-2-yl)ethanone (PubChem CID 135059905) has the molecular formula C20H16N2O and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-(4-methyl-9-phenylpyrido[2,3-b]indol-2-yl)ethanone.
| Compound Name | 1-(4-methyl-9-phenylpyrido[2,3-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 135059905 |
| Molecular Formula | C20H16N2O |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-(4-methyl-9-phenylpyrido[2,3-b]indol-2-yl)ethanone |
| SMILES | CC(=O)c1cc(C)c2c3ccccc3n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C20H16N2O/c1-13-12-17(14(2)23)21-20-19(13)16-10-6-7-11-18(16)22(20)15-8-4-3-5-9-15/h3-12H,1-2H3 |
| InChIKey | FXOQHDUTSJUGOU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |