C20H16N2O2 — CID 162411116
methyl 1-methyl-5-phenylpyrido[4,3-b]indole-3-carboxylate (PubChem CID 162411116) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl 1-methyl-5-phenylpyrido[4,3-b]indole-3-carboxylate.
| Compound Name | methyl 1-methyl-5-phenylpyrido[4,3-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 162411116 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | methyl 1-methyl-5-phenylpyrido[4,3-b]indole-3-carboxylate |
| SMILES | COC(=O)c1cc2c(c(C)n1)c1ccccc1n2-c1ccccc1 |
| InChI | InChI=1S/C20H16N2O2/c1-13-19-15-10-6-7-11-17(15)22(14-8-4-3-5-9-14)18(19)12-16(21-13)20(23)24-2/h3-12H,1-2H3 |
| InChIKey | WDEIPYXZPQMIBR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |