C20H17NO4 — CID 13220390
methyl 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylate (PubChem CID 13220390) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is methyl 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylate.
| Compound Name | methyl 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 13220390 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | methyl 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylate |
| SMILES | CCOc1c(C(=O)OC)oc2c3ccccc3n(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H17NO4/c1-3-24-18-16-17(25-19(18)20(22)23-2)14-11-7-8-12-15(14)21(16)13-9-5-4-6-10-13/h4-12H,3H2,1-2H3 |
| InChIKey | SQGMODLFBXUZFC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |