3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid

C19H15NO4 — CID 13220395

IUPAC3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid
SMILESCCOc1c(C(=O)O)oc2c3ccccc3n(-c3ccccc3)c12
InChIInChI=1S/C19H15NO4/c1-2-23-17-15-16(24-18(17)19(21)22)13-10-6-7-11-14(13)20(15)12-8-4-3-5-9-12/h3-11H,2H2,1H3,(H,21,22)
InChIKeyYUEDRIPQRRVFJV-UHFFFAOYSA-N
MW321.33 g/mol
LogP4.47
Rot. Bonds4

About 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid

3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid (PubChem CID 13220395) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid.

Molecular Properties

Compound Name3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid
PubChem CID13220395
Molecular FormulaC19H15NO4
Molecular Weight321.33 g/mol
Exact Mass321.10
IUPAC Name3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid
SMILESCCOc1c(C(=O)O)oc2c3ccccc3n(-c3ccccc3)c12
InChIInChI=1S/C19H15NO4/c1-2-23-17-15-16(24-18(17)19(21)22)13-10-6-7-11-14(13)20(15)12-8-4-3-5-9-12/h3-11H,2H2,1H3,(H,21,22)
InChIKeyYUEDRIPQRRVFJV-UHFFFAOYSA-N
XLogP4.47
TPSA64.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500321.33
LogP ≤ 54.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid?
The IUPAC name of 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid (CID 13220395) is 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid.
What is the SMILES notation for 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid?
The canonical SMILES for 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid is CCOc1c(C(=O)O)oc2c3ccccc3n(-c3ccccc3)c12.
What is the InChIKey of 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid?
The InChIKey is YUEDRIPQRRVFJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO4/c1-2-23-17-15-16(24-18(17)19(21)22)13-10-6-7-11-14(13)20(15)12-8-4-3-5-9-12/h3-11H,2H2,1H3,(H,21,22).
What are the key properties of 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid?
3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid has a molecular weight of 321.33 g/mol, XLogP of 4.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid is sourced from PubChem (CID 13220395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).