C19H15NO4 — CID 13220395
3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid (PubChem CID 13220395) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid.
| Compound Name | 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 13220395 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-ethoxy-4-phenylfuro[3,2-b]indole-2-carboxylic acid |
| SMILES | CCOc1c(C(=O)O)oc2c3ccccc3n(-c3ccccc3)c12 |
| InChI | InChI=1S/C19H15NO4/c1-2-23-17-15-16(24-18(17)19(21)22)13-10-6-7-11-14(13)20(15)12-8-4-3-5-9-12/h3-11H,2H2,1H3,(H,21,22) |
| InChIKey | YUEDRIPQRRVFJV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |