C29H18N4O2 — CID 170401406
10,20-diphenyl-1,10,12,20-tetrazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-3(11),4,6,8,12,14,16,18-octaene-2,21-dione (PubChem CID 170401406) has the molecular formula C29H18N4O2 and a molecular weight of 454.49 g/mol. Its IUPAC name is 10,20-diphenyl-1,10,12,20-tetrazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-3(11),4,6,8,12,14,16,18-octaene-2,21-dione.
| Compound Name | 10,20-diphenyl-1,10,12,20-tetrazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-3(11),4,6,8,12,14,16,18-octaene-2,21-dione |
|---|---|
| PubChem CID | 170401406 |
| Molecular Formula | C29H18N4O2 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 10,20-diphenyl-1,10,12,20-tetrazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-3(11),4,6,8,12,14,16,18-octaene-2,21-dione |
| SMILES | O=c1c2c3ccccc3n(-c3ccccc3)c2nc2c3ccccc3n(-c3ccccc3)c(=O)n12 |
| InChI | InChI=1S/C29H18N4O2/c34-28-25-21-15-7-9-17-23(21)31(19-11-3-1-4-12-19)27(25)30-26-22-16-8-10-18-24(22)32(29(35)33(26)28)20-13-5-2-6-14-20/h1-18H |
| InChIKey | NXBZOGMBGJOSPA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|