C17H13IN2O — CID 86053721
5-iodo-6-methyl-1,3-diphenylpyrazin-2-one (PubChem CID 86053721) has the molecular formula C17H13IN2O and a molecular weight of 388.21 g/mol. Its IUPAC name is 5-iodo-6-methyl-1,3-diphenylpyrazin-2-one.
| Compound Name | 5-iodo-6-methyl-1,3-diphenylpyrazin-2-one |
|---|---|
| PubChem CID | 86053721 |
| Molecular Formula | C17H13IN2O |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 5-iodo-6-methyl-1,3-diphenylpyrazin-2-one |
| SMILES | Cc1c(I)nc(-c2ccccc2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C17H13IN2O/c1-12-16(18)19-15(13-8-4-2-5-9-13)17(21)20(12)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | MYHOMWTUKXORJU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|