C16H13NO2 — CID 134935741
4-methyl-3,5-diphenyl-1,3-oxazol-2-one (PubChem CID 134935741) has the molecular formula C16H13NO2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 4-methyl-3,5-diphenyl-1,3-oxazol-2-one.
| Compound Name | 4-methyl-3,5-diphenyl-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 134935741 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 4-methyl-3,5-diphenyl-1,3-oxazol-2-one |
| SMILES | Cc1c(-c2ccccc2)oc(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C16H13NO2/c1-12-15(13-8-4-2-5-9-13)19-16(18)17(12)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | ITAXKUKODYYZHH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |