C14H10N2O3 — CID 154131571
3,4-diphenyl-1,3,4-oxadiazolidine-2,5-dione (PubChem CID 154131571) has the molecular formula C14H10N2O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 3,4-diphenyl-1,3,4-oxadiazolidine-2,5-dione.
| Compound Name | 3,4-diphenyl-1,3,4-oxadiazolidine-2,5-dione |
|---|---|
| PubChem CID | 154131571 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3,4-diphenyl-1,3,4-oxadiazolidine-2,5-dione |
| SMILES | O=c1oc(=O)n(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C14H10N2O3/c17-13-15(11-7-3-1-4-8-11)16(14(18)19-13)12-9-5-2-6-10-12/h1-10H |
| InChIKey | DOLDPXIZJOITDK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 57.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |