C17H13NO3 — CID 13219285
5-methyl-3,6-diphenyl-1,3-oxazine-2,4-dione (PubChem CID 13219285) has the molecular formula C17H13NO3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-methyl-3,6-diphenyl-1,3-oxazine-2,4-dione.
| Compound Name | 5-methyl-3,6-diphenyl-1,3-oxazine-2,4-dione |
|---|---|
| PubChem CID | 13219285 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 5-methyl-3,6-diphenyl-1,3-oxazine-2,4-dione |
| SMILES | Cc1c(-c2ccccc2)oc(=O)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C17H13NO3/c1-12-15(13-8-4-2-5-9-13)21-17(20)18(16(12)19)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | XDDVUPYAYXNMJI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |