C17H14N2O2 — CID 102443684
5-methyl-3,6-diphenyl-1H-pyrimidine-2,4-dione (PubChem CID 102443684) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-methyl-3,6-diphenyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-methyl-3,6-diphenyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102443684 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 5-methyl-3,6-diphenyl-1H-pyrimidine-2,4-dione |
| SMILES | Cc1c(-c2ccccc2)[nH]c(=O)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C17H14N2O2/c1-12-15(13-8-4-2-5-9-13)18-17(21)19(16(12)20)14-10-6-3-7-11-14/h2-11H,1H3,(H,18,21) |
| InChIKey | NXHYDRFFVDWFQW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |