C17H15N2O6P — CID 100959268
[3-(4-methoxyphenyl)-2,4-dioxo-6-phenyl-1H-pyrimidin-5-yl]phosphonic acid (PubChem CID 100959268) has the molecular formula C17H15N2O6P and a molecular weight of 374.29 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-2,4-dioxo-6-phenyl-1H-pyrimidin-5-yl]phosphonic acid.
| Compound Name | [3-(4-methoxyphenyl)-2,4-dioxo-6-phenyl-1H-pyrimidin-5-yl]phosphonic acid |
|---|---|
| PubChem CID | 100959268 |
| Molecular Formula | C17H15N2O6P |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [3-(4-methoxyphenyl)-2,4-dioxo-6-phenyl-1H-pyrimidin-5-yl]phosphonic acid |
| SMILES | COc1ccc(-n2c(=O)[nH]c(-c3ccccc3)c(P(=O)(O)O)c2=O)cc1 |
| InChI | InChI=1S/C17H15N2O6P/c1-25-13-9-7-12(8-10-13)19-16(20)15(26(22,23)24)14(18-17(19)21)11-5-3-2-4-6-11/h2-10H,1H3,(H,18,21)(H2,22,23,24) |
| InChIKey | CWBSUVGQZGZKND-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|